C23H45N — CID 126641636
N-[(Z,9R)-3,4,6,6,9,11-hexamethylhexadec-4-en-8-yl]methanimine (PubChem CID 126641636) has the molecular formula C23H45N and a molecular weight of 335.62 g/mol. Its IUPAC name is N-[(Z,9R)-3,4,6,6,9,11-hexamethylhexadec-4-en-8-yl]methanimine.
| Compound Name | N-[(Z,9R)-3,4,6,6,9,11-hexamethylhexadec-4-en-8-yl]methanimine |
|---|---|
| PubChem CID | 126641636 |
| Molecular Formula | C23H45N |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 335.36 |
| IUPAC Name | N-[(Z,9R)-3,4,6,6,9,11-hexamethylhexadec-4-en-8-yl]methanimine |
| SMILES | C=NC(CC(C)(C)/C=C(/C)C(C)CC)[C@H](C)CC(C)CCCCC |
| InChI | InChI=1S/C23H45N/c1-10-12-13-14-18(3)15-20(5)22(24-9)17-23(7,8)16-21(6)19(4)11-2/h16,18-20,22H,9-15,17H2,1-8H3/b21-16-/t18?,19?,20-,22?/m1/s1 |
| InChIKey | DPSAONAQGPGROR-AQSQCLFDSA-N |
| XLogP | 7.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|