C23H23N3 — CID 126641747
N-ethyl-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]aniline (PubChem CID 126641747) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-ethyl-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]aniline.
| Compound Name | N-ethyl-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]aniline |
|---|---|
| PubChem CID | 126641747 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-ethyl-3-[3-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]aniline |
| SMILES | C=C/C=C\C(=C/C=C)c1c[nH]c2ncc(-c3cccc(NCC)c3)cc12 |
| InChI | InChI=1S/C23H23N3/c1-4-7-10-17(9-5-2)22-16-26-23-21(22)14-19(15-25-23)18-11-8-12-20(13-18)24-6-3/h4-5,7-16,24H,1-2,6H2,3H3,(H,25,26)/b10-7-,17-9+ |
| InChIKey | DXUASKBZZZGVDD-XXOGSWOASA-N |
| XLogP | 5.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|