C26H31ClF3N7O2 — CID 126641929
3-[4-[(3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine;2,2,2-trifluoroacetic acid (PubChem CID 126641929) has the molecular formula C26H31ClF3N7O2 and a molecular weight of 566.03 g/mol. Its IUPAC name is 3-[4-[(3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[(3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 126641929 |
| Molecular Formula | C26H31ClF3N7O2 |
| Molecular Weight | 566.03 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 3-[4-[(3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl]piperidin-1-yl]-1H-1,2,4-triazol-5-amine;2,2,2-trifluoroacetic acid |
| SMILES | CN1C[C@H](Cc2ccc(Cl)cc2)N(C2CCN(c3n[nH]c(N)n3)CC2)Cc2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H30ClN7.C2HF3O2/c1-30-16-21(14-17-6-8-19(25)9-7-17)32(15-18-4-2-3-5-22(18)30)20-10-12-31(13-11-20)24-27-23(26)28-29-24;3-2(4,5)1(6)7/h2-9,20-21H,10-16H2,1H3,(H3,26,27,28,29);(H,6,7)/t21-;/m0./s1 |
| InChIKey | RKERWHHIOAPIRK-BOXHHOBZSA-N |
| XLogP | 4.21 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.03 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |