About (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one
(3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one (PubChem CID 126642033) has the molecular formula C17H17ClN2O
and a molecular weight of 300.79 g/mol. Its IUPAC name is (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one.
Molecular Properties
| Compound Name | (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one |
| PubChem CID | 126642033 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one |
| SMILES | CN1C[C@H](Cc2ccc(Cl)cc2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C17H17ClN2O/c1-20-11-14(10-12-6-8-13(18)9-7-12)19-17(21)15-4-2-3-5-16(15)20/h2-9,14H,10-11H2,1H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | VKJKZJAOCNLWDI-AWEZNQCLSA-N |
| XLogP | 3.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one?
The IUPAC name of (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one (CID 126642033) is (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one.
What is the SMILES notation for (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one?
The canonical SMILES for (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one is CN1C[C@H](Cc2ccc(Cl)cc2)NC(=O)c2ccccc21.
What is the InChIKey of (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one?
The InChIKey is VKJKZJAOCNLWDI-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H17ClN2O/c1-20-11-14(10-12-6-8-13(18)9-7-12)19-17(21)15-4-2-3-5-16(15)20/h2-9,14H,10-11H2,1H3,(H,19,21)/t14-/m0/s1.
What are the key properties of (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one?
(3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one has a molecular weight of 300.79 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(4-chlorophenyl)methyl]-1-methyl-3,4-dihydro-2H-1,4-benzodiazepin-5-one is sourced from PubChem (CID 126642033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).