C14H11F5N6O — CID 126642557
4-[1-(4,4,5,5,5-pentafluoropentyl)-1,2,4-triazol-3-yl]benzoyl azide (PubChem CID 126642557) has the molecular formula C14H11F5N6O and a molecular weight of 374.27 g/mol. Its IUPAC name is 4-[1-(4,4,5,5,5-pentafluoropentyl)-1,2,4-triazol-3-yl]benzoyl azide.
| Compound Name | 4-[1-(4,4,5,5,5-pentafluoropentyl)-1,2,4-triazol-3-yl]benzoyl azide |
|---|---|
| PubChem CID | 126642557 |
| Molecular Formula | C14H11F5N6O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 4-[1-(4,4,5,5,5-pentafluoropentyl)-1,2,4-triazol-3-yl]benzoyl azide |
| SMILES | [N-]=[N+]=NC(=O)c1ccc(-c2ncn(CCCC(F)(F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H11F5N6O/c15-13(16,14(17,18)19)6-1-7-25-8-21-11(23-25)9-2-4-10(5-3-9)12(26)22-24-20/h2-5,8H,1,6-7H2 |
| InChIKey | FWFIPFXLSQKDAY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 96.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|