About 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline
4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline (PubChem CID 126642558) has the molecular formula C17H15F3N4O
and a molecular weight of 348.33 g/mol. Its IUPAC name is 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline.
Molecular Properties
| Compound Name | 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline |
| PubChem CID | 126642558 |
| Molecular Formula | C17H15F3N4O |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2ncn(CCc3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H15F3N4O/c18-17(19,20)25-15-7-1-12(2-8-15)9-10-24-11-22-16(23-24)13-3-5-14(21)6-4-13/h1-8,11H,9-10,21H2 |
| InChIKey | IKMMUQUETKWVBK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline?
The IUPAC name of 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline (CID 126642558) is 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline.
What is the SMILES notation for 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline?
The canonical SMILES for 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline is Nc1ccc(-c2ncn(CCc3ccc(OC(F)(F)F)cc3)n2)cc1.
What is the InChIKey of 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline?
The InChIKey is IKMMUQUETKWVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4O/c18-17(19,20)25-15-7-1-12(2-8-15)9-10-24-11-22-16(23-24)13-3-5-14(21)6-4-13/h1-8,11H,9-10,21H2.
What are the key properties of 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline?
4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline has a molecular weight of 348.33 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[2-[4-(trifluoromethoxy)phenyl]ethyl]-1,2,4-triazol-3-yl]aniline is sourced from PubChem (CID 126642558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).