About 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine
3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine (PubChem CID 126643371) has the molecular formula C7H11ClN6
and a molecular weight of 214.66 g/mol. Its IUPAC name is 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine.
Molecular Properties
| Compound Name | 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine |
| PubChem CID | 126643371 |
| Molecular Formula | C7H11ClN6 |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine |
| SMILES | Nc1nc(N2CCC(N)C2)nnc1Cl |
| InChI | InChI=1S/C7H11ClN6/c8-5-6(10)11-7(13-12-5)14-2-1-4(9)3-14/h4H,1-3,9H2,(H2,10,11,13) |
| InChIKey | INRISABFJVNQBD-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine?
The IUPAC name of 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine (CID 126643371) is 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine.
What is the SMILES notation for 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine?
The canonical SMILES for 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine is Nc1nc(N2CCC(N)C2)nnc1Cl.
What is the InChIKey of 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine?
The InChIKey is INRISABFJVNQBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN6/c8-5-6(10)11-7(13-12-5)14-2-1-4(9)3-14/h4H,1-3,9H2,(H2,10,11,13).
What are the key properties of 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine?
3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine has a molecular weight of 214.66 g/mol, XLogP of -0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminopyrrolidin-1-yl)-6-chloro-1,2,4-triazin-5-amine is sourced from PubChem (CID 126643371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).