About 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide
2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide (PubChem CID 126644075) has the molecular formula C15H19N5O2
and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide |
| PubChem CID | 126644075 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide |
| SMILES | Cn1cc(-c2cnc(N)c(C(=O)N[C@H]3CCC[C@@H]3O)c2)cn1 |
| InChI | InChI=1S/C15H19N5O2/c1-20-8-10(7-18-20)9-5-11(14(16)17-6-9)15(22)19-12-3-2-4-13(12)21/h5-8,12-13,21H,2-4H2,1H3,(H2,16,17)(H,19,22)/t12-,13-/m0/s1 |
| InChIKey | CARFAFSQEPQUGN-STQMWFEESA-N |
| XLogP | 0.71 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide?
The IUPAC name of 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide (CID 126644075) is 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide.
What is the SMILES notation for 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide?
The canonical SMILES for 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide is Cn1cc(-c2cnc(N)c(C(=O)N[C@H]3CCC[C@@H]3O)c2)cn1.
What is the InChIKey of 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide?
The InChIKey is CARFAFSQEPQUGN-STQMWFEESA-N. The full InChI is InChI=1S/C15H19N5O2/c1-20-8-10(7-18-20)9-5-11(14(16)17-6-9)15(22)19-12-3-2-4-13(12)21/h5-8,12-13,21H,2-4H2,1H3,(H2,16,17)(H,19,22)/t12-,13-/m0/s1.
What are the key properties of 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide?
2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide has a molecular weight of 301.35 g/mol, XLogP of 0.71, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(1S,2S)-2-hydroxycyclopentyl]-5-(1-methylpyrazol-4-yl)pyridine-3-carboxamide is sourced from PubChem (CID 126644075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).