C27H30N4O4 — CID 126644195
3-amino-5-[6-amino-5-[[(1S,2S)-2-[(3,4-dimethylphenyl)methoxy]cyclopentyl]carbamoyl]-3-pyridinyl]benzoic acid (PubChem CID 126644195) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 3-amino-5-[6-amino-5-[[(1S,2S)-2-[(3,4-dimethylphenyl)methoxy]cyclopentyl]carbamoyl]-3-pyridinyl]benzoic acid.
| Compound Name | 3-amino-5-[6-amino-5-[[(1S,2S)-2-[(3,4-dimethylphenyl)methoxy]cyclopentyl]carbamoyl]-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 126644195 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 3-amino-5-[6-amino-5-[[(1S,2S)-2-[(3,4-dimethylphenyl)methoxy]cyclopentyl]carbamoyl]-3-pyridinyl]benzoic acid |
| SMILES | Cc1ccc(CO[C@H]2CCC[C@@H]2NC(=O)c2cc(-c3cc(N)cc(C(=O)O)c3)cnc2N)cc1C |
| InChI | InChI=1S/C27H30N4O4/c1-15-6-7-17(8-16(15)2)14-35-24-5-3-4-23(24)31-26(32)22-12-20(13-30-25(22)29)18-9-19(27(33)34)11-21(28)10-18/h6-13,23-24H,3-5,14,28H2,1-2H3,(H2,29,30)(H,31,32)(H,33,34)/t23-,24-/m0/s1 |
| InChIKey | LUVKMLLQMCZBGO-ZEQRLZLVSA-N |
| XLogP | 4.10 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|