C22H22F3N5O2 — CID 126644284
2-amino-5-(1-methylpyrazol-4-yl)-N-[2-[(2,4,5-trifluorophenyl)methoxy]cyclopentyl]pyridine-3-carboxamide (PubChem CID 126644284) has the molecular formula C22H22F3N5O2 and a molecular weight of 445.45 g/mol. Its IUPAC name is 2-amino-5-(1-methylpyrazol-4-yl)-N-[2-[(2,4,5-trifluorophenyl)methoxy]cyclopentyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-5-(1-methylpyrazol-4-yl)-N-[2-[(2,4,5-trifluorophenyl)methoxy]cyclopentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126644284 |
| Molecular Formula | C22H22F3N5O2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-amino-5-(1-methylpyrazol-4-yl)-N-[2-[(2,4,5-trifluorophenyl)methoxy]cyclopentyl]pyridine-3-carboxamide |
| SMILES | Cn1cc(-c2cnc(N)c(C(=O)NC3CCCC3OCc3cc(F)c(F)cc3F)c2)cn1 |
| InChI | InChI=1S/C22H22F3N5O2/c1-30-10-14(9-28-30)12-5-15(21(26)27-8-12)22(31)29-19-3-2-4-20(19)32-11-13-6-17(24)18(25)7-16(13)23/h5-10,19-20H,2-4,11H2,1H3,(H2,26,27)(H,29,31) |
| InChIKey | RINLFOKZGCSKDD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|