C35H39F4N7O2 — CID 126644687
2-amino-N-[(1S,2S)-2-[[4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]methoxy]cyclopentyl]-5-[1-(1,1,2,2-tetrafluoroethyl)pyrazol-4-yl]pyridine-3-carboxamide (PubChem CID 126644687) has the molecular formula C35H39F4N7O2 and a molecular weight of 665.74 g/mol. Its IUPAC name is 2-amino-N-[(1S,2S)-2-[[4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]methoxy]cyclopentyl]-5-[1-(1,1,2,2-tetrafluoroethyl)pyrazol-4-yl]pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[(1S,2S)-2-[[4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]methoxy]cyclopentyl]-5-[1-(1,1,2,2-tetrafluoroethyl)pyrazol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126644687 |
| Molecular Formula | C35H39F4N7O2 |
| Molecular Weight | 665.74 g/mol |
| Exact Mass | 665.31 |
| IUPAC Name | 2-amino-N-[(1S,2S)-2-[[4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]phenyl]methoxy]cyclopentyl]-5-[1-(1,1,2,2-tetrafluoroethyl)pyrazol-4-yl]pyridine-3-carboxamide |
| SMILES | CN1CCN(Cc2ccc(-c3ccc(CO[C@H]4CCC[C@@H]4NC(=O)c4cc(-c5cnn(C(F)(F)C(F)F)c5)cnc4N)cc3)cc2)CC1 |
| InChI | InChI=1S/C35H39F4N7O2/c1-44-13-15-45(16-14-44)20-23-5-9-25(10-6-23)26-11-7-24(8-12-26)22-48-31-4-2-3-30(31)43-33(47)29-17-27(18-41-32(29)40)28-19-42-46(21-28)35(38,39)34(36)37/h5-12,17-19,21,30-31,34H,2-4,13-16,20,22H2,1H3,(H2,40,41)(H,43,47)/t30-,31-/m0/s1 |
| InChIKey | KYYNTCNEKSRYCI-CONSDPRKSA-N |
| XLogP | 5.62 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|