C12H20N4O4 — CID 12664496
4,4,5,10,10,11-hexamethyl-2,8-dioxa-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodecane-6,12-dione (PubChem CID 12664496) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4,4,5,10,10,11-hexamethyl-2,8-dioxa-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodecane-6,12-dione.
| Compound Name | 4,4,5,10,10,11-hexamethyl-2,8-dioxa-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodecane-6,12-dione |
|---|---|
| PubChem CID | 12664496 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4,4,5,10,10,11-hexamethyl-2,8-dioxa-1,5,7,11-tetrazatricyclo[7.3.0.03,7]dodecane-6,12-dione |
| SMILES | CN1C(=O)N2OC3N(OC2C1(C)C)C(=O)N(C)C3(C)C |
| InChI | InChI=1S/C12H20N4O4/c1-11(2)7-15(9(17)13(11)5)20-8-12(3,4)14(6)10(18)16(8)19-7/h7-8H,1-6H3 |
| InChIKey | FQMWNLDFCFCFHX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |