C22H24F3NO3 — CID 126645127
1-[3-[2-butoxy-5-(1,2,2-trifluoroethyl)phenyl]phenyl]azetidine-3-carboxylic acid (PubChem CID 126645127) has the molecular formula C22H24F3NO3 and a molecular weight of 407.43 g/mol. Its IUPAC name is 1-[3-[2-butoxy-5-(1,2,2-trifluoroethyl)phenyl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[3-[2-butoxy-5-(1,2,2-trifluoroethyl)phenyl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 126645127 |
| Molecular Formula | C22H24F3NO3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-[3-[2-butoxy-5-(1,2,2-trifluoroethyl)phenyl]phenyl]azetidine-3-carboxylic acid |
| SMILES | CCCCOc1ccc(C(F)C(F)F)cc1-c1cccc(N2CC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C22H24F3NO3/c1-2-3-9-29-19-8-7-15(20(23)21(24)25)11-18(19)14-5-4-6-17(10-14)26-12-16(13-26)22(27)28/h4-8,10-11,16,20-21H,2-3,9,12-13H2,1H3,(H,27,28) |
| InChIKey | ACJWIVRPIPQAMY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|