C13H14F3N — CID 126645507
6-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-carbazole (PubChem CID 126645507) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-carbazole.
| Compound Name | 6-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-carbazole |
|---|---|
| PubChem CID | 126645507 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-carbazole |
| SMILES | FC(F)(F)C1C=CC2=C(C1)C1CCCCC1=N2 |
| InChI | InChI=1S/C13H14F3N/c14-13(15,16)8-5-6-12-10(7-8)9-3-1-2-4-11(9)17-12/h5-6,8-9H,1-4,7H2 |
| InChIKey | OKBBMYQTWIYRJO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |