About 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide
4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide (PubChem CID 126645654) has the molecular formula C17H14F3N5O2
and a molecular weight of 377.33 g/mol. Its IUPAC name is 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide.
Molecular Properties
| Compound Name | 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide |
| PubChem CID | 126645654 |
| Molecular Formula | C17H14F3N5O2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide |
| SMILES | CN(C(=O)c1ccc(N)cc1)c1ncn(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H14F3N5O2/c1-24(15(26)11-2-4-12(21)5-3-11)16-22-10-25(23-16)13-6-8-14(9-7-13)27-17(18,19)20/h2-10H,21H2,1H3 |
| InChIKey | UGJSFYBZKFSOAG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide?
The IUPAC name of 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide (CID 126645654) is 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide.
What is the SMILES notation for 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide?
The canonical SMILES for 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide is CN(C(=O)c1ccc(N)cc1)c1ncn(-c2ccc(OC(F)(F)F)cc2)n1.
What is the InChIKey of 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide?
The InChIKey is UGJSFYBZKFSOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F3N5O2/c1-24(15(26)11-2-4-12(21)5-3-11)16-22-10-25(23-16)13-6-8-14(9-7-13)27-17(18,19)20/h2-10H,21H2,1H3.
What are the key properties of 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide?
4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide has a molecular weight of 377.33 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-methyl-N-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide is sourced from PubChem (CID 126645654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).