C19H16FN3O5 — CID 126645661
4-[(6-fluoro-1,3-benzoxazol-2-yl)methyl]-N-hydroxy-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 126645661) has the molecular formula C19H16FN3O5 and a molecular weight of 385.35 g/mol. Its IUPAC name is 4-[(6-fluoro-1,3-benzoxazol-2-yl)methyl]-N-hydroxy-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-[(6-fluoro-1,3-benzoxazol-2-yl)methyl]-N-hydroxy-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 126645661 |
| Molecular Formula | C19H16FN3O5 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[(6-fluoro-1,3-benzoxazol-2-yl)methyl]-N-hydroxy-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | CC1(C)Oc2ccc(C(=O)NO)cc2N(Cc2nc3ccc(F)cc3o2)C1=O |
| InChI | InChI=1S/C19H16FN3O5/c1-19(2)18(25)23(9-16-21-12-5-4-11(20)8-15(12)27-16)13-7-10(17(24)22-26)3-6-14(13)28-19/h3-8,26H,9H2,1-2H3,(H,22,24) |
| InChIKey | OGTHRWUICQKFJI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 104.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|