C22H21F5N6O2 — CID 126645668
[4-[[(1R,2R,4R)-4-(difluoromethyl)-2-hydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]methanone (PubChem CID 126645668) has the molecular formula C22H21F5N6O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is [4-[[(1R,2R,4R)-4-(difluoromethyl)-2-hydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]methanone.
| Compound Name | [4-[[(1R,2R,4R)-4-(difluoromethyl)-2-hydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 126645668 |
| Molecular Formula | C22H21F5N6O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [4-[[(1R,2R,4R)-4-(difluoromethyl)-2-hydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]methanone |
| SMILES | O=C(c1[nH]nc2ncnc(N[C@@H]3C[C@@H](C(F)F)C[C@H]3O)c12)N1C[C@@H](F)C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C22H21F5N6O2/c23-10-1-2-13(25)12(5-10)15-6-11(24)7-33(15)22(35)18-17-20(28-8-29-21(17)32-31-18)30-14-3-9(19(26)27)4-16(14)34/h1-2,5,8-9,11,14-16,19,34H,3-4,6-7H2,(H2,28,29,30,31,32)/t9-,11+,14-,15-,16-/m1/s1 |
| InChIKey | WRRBWAZRKBXRPO-XDDVRUDJSA-N |
| XLogP | 3.37 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |