C12H13F2NO5S — CID 126645896
(2R,4R)-2-(2,5-difluorophenyl)-4-methylsulfonyloxypyrrolidine-1-carboxylic acid (PubChem CID 126645896) has the molecular formula C12H13F2NO5S and a molecular weight of 321.30 g/mol. Its IUPAC name is (2R,4R)-2-(2,5-difluorophenyl)-4-methylsulfonyloxypyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4R)-2-(2,5-difluorophenyl)-4-methylsulfonyloxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 126645896 |
| Molecular Formula | C12H13F2NO5S |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (2R,4R)-2-(2,5-difluorophenyl)-4-methylsulfonyloxypyrrolidine-1-carboxylic acid |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@H](c2cc(F)ccc2F)N(C(=O)O)C1 |
| InChI | InChI=1S/C12H13F2NO5S/c1-21(18,19)20-8-5-11(15(6-8)12(16)17)9-4-7(13)2-3-10(9)14/h2-4,8,11H,5-6H2,1H3,(H,16,17)/t8-,11-/m1/s1 |
| InChIKey | LSZZCQDZNGSPRN-LDYMZIIASA-N |
| XLogP | 1.73 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|