About 3-thiophen-2-ylimidazo[1,5-a]pyridine
3-thiophen-2-ylimidazo[1,5-a]pyridine (PubChem CID 1266459) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is 3-thiophen-2-ylimidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 3-thiophen-2-ylimidazo[1,5-a]pyridine |
| PubChem CID | 1266459 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-thiophen-2-ylimidazo[1,5-a]pyridine |
| SMILES | c1csc(-c2ncc3ccccn23)c1 |
| InChI | InChI=1S/C11H8N2S/c1-2-6-13-9(4-1)8-12-11(13)10-5-3-7-14-10/h1-8H |
| InChIKey | GIEMOICNGNRDKF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thiophen-2-ylimidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-ylimidazo[1,5-a]pyridine?
The IUPAC name of 3-thiophen-2-ylimidazo[1,5-a]pyridine (CID 1266459) is 3-thiophen-2-ylimidazo[1,5-a]pyridine.
What is the SMILES notation for 3-thiophen-2-ylimidazo[1,5-a]pyridine?
The canonical SMILES for 3-thiophen-2-ylimidazo[1,5-a]pyridine is c1csc(-c2ncc3ccccn23)c1.
What is the InChIKey of 3-thiophen-2-ylimidazo[1,5-a]pyridine?
The InChIKey is GIEMOICNGNRDKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c1-2-6-13-9(4-1)8-12-11(13)10-5-3-7-14-10/h1-8H.
What are the key properties of 3-thiophen-2-ylimidazo[1,5-a]pyridine?
3-thiophen-2-ylimidazo[1,5-a]pyridine has a molecular weight of 200.27 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-ylimidazo[1,5-a]pyridine is sourced from PubChem (CID 1266459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).