C19H20F2N6O4S — CID 126646230
N-[(2,5-difluorophenyl)methyl]-4-[[(1S,2S,4S)-2-hydroxy-4-methylsulfonylcyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126646230) has the molecular formula C19H20F2N6O4S and a molecular weight of 466.47 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-4-[[(1S,2S,4S)-2-hydroxy-4-methylsulfonylcyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-4-[[(1S,2S,4S)-2-hydroxy-4-methylsulfonylcyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126646230 |
| Molecular Formula | C19H20F2N6O4S |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-4-[[(1S,2S,4S)-2-hydroxy-4-methylsulfonylcyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | CS(=O)(=O)[C@H]1C[C@H](Nc2ncnc3n[nH]c(C(=O)NCc4cc(F)ccc4F)c23)[C@@H](O)C1 |
| InChI | InChI=1S/C19H20F2N6O4S/c1-32(30,31)11-5-13(14(28)6-11)25-17-15-16(26-27-18(15)24-8-23-17)19(29)22-7-9-4-10(20)2-3-12(9)21/h2-4,8,11,13-14,28H,5-7H2,1H3,(H,22,29)(H2,23,24,25,26,27)/t11-,13-,14-/m0/s1 |
| InChIKey | MOGDFRWOENIEPK-UBHSHLNASA-N |
| XLogP | 0.91 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |