C25H27N5O6 — CID 126646856
[(2S)-3-methyl-1-[2-[5-(4-nitro-3-phenoxyphenyl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamic acid (PubChem CID 126646856) has the molecular formula C25H27N5O6 and a molecular weight of 493.52 g/mol. Its IUPAC name is [(2S)-3-methyl-1-[2-[5-(4-nitro-3-phenoxyphenyl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-methyl-1-[2-[5-(4-nitro-3-phenoxyphenyl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 126646856 |
| Molecular Formula | C25H27N5O6 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | [(2S)-3-methyl-1-[2-[5-(4-nitro-3-phenoxyphenyl)-1H-imidazol-2-yl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)[C@H](NC(=O)O)C(=O)N1CCCC1c1ncc(-c2ccc([N+](=O)[O-])c(Oc3ccccc3)c2)[nH]1 |
| InChI | InChI=1S/C25H27N5O6/c1-15(2)22(28-25(32)33)24(31)29-12-6-9-20(29)23-26-14-18(27-23)16-10-11-19(30(34)35)21(13-16)36-17-7-4-3-5-8-17/h3-5,7-8,10-11,13-15,20,22,28H,6,9,12H2,1-2H3,(H,26,27)(H,32,33)/t20?,22-/m0/s1 |
| InChIKey | KCWFTGWJCNPGGH-IAXKEJLGSA-N |
| XLogP | 4.73 |
| TPSA | 150.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|