C20H30O3 — CID 126647339
ethyl (E)-3-[(1R,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]-2-methylprop-2-enoate (PubChem CID 126647339) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is ethyl (E)-3-[(1R,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[(1R,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126647339 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | ethyl (E)-3-[(1R,8aS)-1-formyl-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-2-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/C1=CCC2C(C)(C)CCC[C@]2(C)[C@H]1C=O |
| InChI | InChI=1S/C20H30O3/c1-6-23-18(22)14(2)12-15-8-9-17-19(3,4)10-7-11-20(17,5)16(15)13-21/h8,12-13,16-17H,6-7,9-11H2,1-5H3/b14-12+/t16-,17?,20+/m0/s1 |
| InChIKey | SRYUENSPMDGGLE-NYOCGODKSA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|