About (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine
(3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine (PubChem CID 126648024) has the molecular formula C8H16FN
and a molecular weight of 145.22 g/mol. Its IUPAC name is (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine |
| PubChem CID | 126648024 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine |
| SMILES | CCN1C[C@H](F)[C@@H](C)C1C |
| InChI | InChI=1S/C8H16FN/c1-4-10-5-8(9)6(2)7(10)3/h6-8H,4-5H2,1-3H3/t6-,7?,8-/m0/s1 |
| InChIKey | OUZWGSJIOJGUQF-PPSBICQBSA-N |
| XLogP | 1.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine?
The IUPAC name of (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine (CID 126648024) is (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine.
What is the SMILES notation for (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine?
The canonical SMILES for (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine is CCN1C[C@H](F)[C@@H](C)C1C.
What is the InChIKey of (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine?
The InChIKey is OUZWGSJIOJGUQF-PPSBICQBSA-N. The full InChI is InChI=1S/C8H16FN/c1-4-10-5-8(9)6(2)7(10)3/h6-8H,4-5H2,1-3H3/t6-,7?,8-/m0/s1.
What are the key properties of (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine?
(3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine has a molecular weight of 145.22 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-ethyl-4-fluoro-2,3-dimethylpyrrolidine is sourced from PubChem (CID 126648024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).