C29H44O4 — CID 126648083
2-[(4E,8E)-11-[(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol (PubChem CID 126648083) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol.
| Compound Name | 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol |
|---|---|
| PubChem CID | 126648083 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol |
| SMILES | C/C(=C\CC/C(C)=C/CC[C@]1(C)CCc2c(C)c(O)c(C)c(C)c2O1)CCC=C(CO)CO |
| InChI | InChI=1S/C29H44O4/c1-20(12-8-14-25(18-30)19-31)10-7-11-21(2)13-9-16-29(6)17-15-26-24(5)27(32)22(3)23(4)28(26)33-29/h10,13-14,30-32H,7-9,11-12,15-19H2,1-6H3/b20-10+,21-13+/t29-/m1/s1 |
| InChIKey | UUHVLERXBOHWNS-VIRYQLDASA-N |
| XLogP | 6.55 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|