C33H49NO4 — CID 126648140
(2E,6E,10E)-13-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2,6,10-trimethyl-1-morpholin-4-yltrideca-2,6,10-trien-1-one (PubChem CID 126648140) has the molecular formula C33H49NO4 and a molecular weight of 523.76 g/mol. Its IUPAC name is (2E,6E,10E)-13-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2,6,10-trimethyl-1-morpholin-4-yltrideca-2,6,10-trien-1-one.
| Compound Name | (2E,6E,10E)-13-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2,6,10-trimethyl-1-morpholin-4-yltrideca-2,6,10-trien-1-one |
|---|---|
| PubChem CID | 126648140 |
| Molecular Formula | C33H49NO4 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | (2E,6E,10E)-13-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2,6,10-trimethyl-1-morpholin-4-yltrideca-2,6,10-trien-1-one |
| SMILES | C/C(=C\CC/C(C)=C/CCC1(C)CCc2c(C)c(O)c(C)c(C)c2O1)CC/C=C(\C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C33H49NO4/c1-23(13-9-15-25(3)32(36)34-19-21-37-22-20-34)11-8-12-24(2)14-10-17-33(7)18-16-29-28(6)30(35)26(4)27(5)31(29)38-33/h11,14-15,35H,8-10,12-13,16-22H2,1-7H3/b23-11+,24-14+,25-15+ |
| InChIKey | CQRDGJYWQGYJMY-SRLKKDCTSA-N |
| XLogP | 7.44 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|