C15H14BrFN2O2 — CID 126648546
5-bromo-N-[(2-fluoro-5-methylphenyl)methyl]-N-methyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 126648546) has the molecular formula C15H14BrFN2O2 and a molecular weight of 353.19 g/mol. Its IUPAC name is 5-bromo-N-[(2-fluoro-5-methylphenyl)methyl]-N-methyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[(2-fluoro-5-methylphenyl)methyl]-N-methyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126648546 |
| Molecular Formula | C15H14BrFN2O2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 5-bromo-N-[(2-fluoro-5-methylphenyl)methyl]-N-methyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1ccc(F)c(CN(C)C(=O)c2cc(Br)c[nH]c2=O)c1 |
| InChI | InChI=1S/C15H14BrFN2O2/c1-9-3-4-13(17)10(5-9)8-19(2)15(21)12-6-11(16)7-18-14(12)20/h3-7H,8H2,1-2H3,(H,18,20) |
| InChIKey | OBSQFRXJBGYPIJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |