About 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid
4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid (PubChem CID 126648625) has the molecular formula C23H19N3O6S
and a molecular weight of 465.49 g/mol. Its IUPAC name is 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid.
Molecular Properties
| Compound Name | 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid |
| PubChem CID | 126648625 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid |
| SMILES | COc1cccc(-n2cc(-c3ccccc3S(=O)(=O)c3ccc(C(=O)O)cc3)nn2)c1OC |
| InChI | InChI=1S/C23H19N3O6S/c1-31-20-8-5-7-19(22(20)32-2)26-14-18(24-25-26)17-6-3-4-9-21(17)33(29,30)16-12-10-15(11-13-16)23(27)28/h3-14H,1-2H3,(H,27,28) |
| InChIKey | QTHYHYHZUPXOLE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid?
The IUPAC name of 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid (CID 126648625) is 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid.
What is the SMILES notation for 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid?
The canonical SMILES for 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid is COc1cccc(-n2cc(-c3ccccc3S(=O)(=O)c3ccc(C(=O)O)cc3)nn2)c1OC.
What is the InChIKey of 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid?
The InChIKey is QTHYHYHZUPXOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O6S/c1-31-20-8-5-7-19(22(20)32-2)26-14-18(24-25-26)17-6-3-4-9-21(17)33(29,30)16-12-10-15(11-13-16)23(27)28/h3-14H,1-2H3,(H,27,28).
What are the key properties of 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid?
4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid has a molecular weight of 465.49 g/mol, XLogP of 3.48, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[1-(2,3-dimethoxyphenyl)triazol-4-yl]phenyl]sulfonylbenzoic acid is sourced from PubChem (CID 126648625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).