About 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide
2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide (PubChem CID 126648772) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide |
| PubChem CID | 126648772 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide |
| SMILES | CN1C=C(C(N)=O)C=C(C(N)=O)C1c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C16H16N4O2/c1-20-8-9(15(17)21)7-12(16(18)22)14(20)11-3-2-4-13-10(11)5-6-19-13/h2-8,14,19H,1H3,(H2,17,21)(H2,18,22) |
| InChIKey | CMHWIUWFELCOFL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide?
The IUPAC name of 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide (CID 126648772) is 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide.
What is the SMILES notation for 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide?
The canonical SMILES for 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide is CN1C=C(C(N)=O)C=C(C(N)=O)C1c1cccc2[nH]ccc12.
What is the InChIKey of 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide?
The InChIKey is CMHWIUWFELCOFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2/c1-20-8-9(15(17)21)7-12(16(18)22)14(20)11-3-2-4-13-10(11)5-6-19-13/h2-8,14,19H,1H3,(H2,17,21)(H2,18,22).
What are the key properties of 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide?
2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide has a molecular weight of 296.33 g/mol, XLogP of 0.94, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-4-yl)-1-methyl-2H-pyridine-3,5-dicarboxamide is sourced from PubChem (CID 126648772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).