About 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide
5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide (PubChem CID 126648941) has the molecular formula C19H21N3O4
and a molecular weight of 355.39 g/mol. Its IUPAC name is 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
| PubChem CID | 126648941 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC2CC2)cn(Cc2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C19H21N3O4/c1-20-18(24)16-9-13(17(23)21-14-5-6-14)11-22(19(16)25)10-12-3-7-15(26-2)8-4-12/h3-4,7-9,11,14H,5-6,10H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | VBSQIPSWUGCQMA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide?
The IUPAC name of 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide (CID 126648941) is 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide.
What is the SMILES notation for 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide?
The canonical SMILES for 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide is CNC(=O)c1cc(C(=O)NC2CC2)cn(Cc2ccc(OC)cc2)c1=O.
What is the InChIKey of 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide?
The InChIKey is VBSQIPSWUGCQMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4/c1-20-18(24)16-9-13(17(23)21-14-5-6-14)11-22(19(16)25)10-12-3-7-15(26-2)8-4-12/h3-4,7-9,11,14H,5-6,10H2,1-2H3,(H,20,24)(H,21,23).
What are the key properties of 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide?
5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide has a molecular weight of 355.39 g/mol, XLogP of 1.16, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-cyclopropyl-1-[(4-methoxyphenyl)methyl]-3-N-methyl-2-oxopyridine-3,5-dicarboxamide is sourced from PubChem (CID 126648941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).