C16H14N4O4S — CID 126649211
N-hydroxy-5-[3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]propyl]-1,2-oxazole-3-carboxamide (PubChem CID 126649211) has the molecular formula C16H14N4O4S and a molecular weight of 358.38 g/mol. Its IUPAC name is N-hydroxy-5-[3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]propyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-hydroxy-5-[3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]propyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 126649211 |
| Molecular Formula | C16H14N4O4S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-hydroxy-5-[3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]propyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CCc1cc(C(=O)NO)no1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H14N4O4S/c21-14(7-6-11-8-12(20-24-11)15(22)19-23)18-16-17-13(9-25-16)10-4-2-1-3-5-10/h1-5,8-9,23H,6-7H2,(H,19,22)(H,17,18,21) |
| InChIKey | FAMQRYJFYVNUIF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|