About [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol
[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol (PubChem CID 126650017) has the molecular formula C27H26FN5O
and a molecular weight of 455.54 g/mol. Its IUPAC name is [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol |
| PubChem CID | 126650017 |
| Molecular Formula | C27H26FN5O |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol |
| SMILES | Cc1ccc(C)n1-c1cc(C(O)c2cnn(-c3ccc(F)cc3)c2)cc(-n2c(C)ccc2C)n1 |
| InChI | InChI=1S/C27H26FN5O/c1-17-5-6-18(2)32(17)25-13-21(14-26(30-25)33-19(3)7-8-20(33)4)27(34)22-15-29-31(16-22)24-11-9-23(28)10-12-24/h5-16,27,34H,1-4H3 |
| InChIKey | NGCQESCZXGRZRU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 60.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol?
The IUPAC name of [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol (CID 126650017) is [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol.
What is the SMILES notation for [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol?
The canonical SMILES for [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol is Cc1ccc(C)n1-c1cc(C(O)c2cnn(-c3ccc(F)cc3)c2)cc(-n2c(C)ccc2C)n1.
What is the InChIKey of [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol?
The InChIKey is NGCQESCZXGRZRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26FN5O/c1-17-5-6-18(2)32(17)25-13-21(14-26(30-25)33-19(3)7-8-20(33)4)27(34)22-15-29-31(16-22)24-11-9-23(28)10-12-24/h5-16,27,34H,1-4H3.
What are the key properties of [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol?
[2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol has a molecular weight of 455.54 g/mol, XLogP of 5.30, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(2,5-dimethylpyrrol-1-yl)-4-pyridinyl]-[1-(4-fluorophenyl)pyrazol-4-yl]methanol is sourced from PubChem (CID 126650017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).