About 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine
7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 126650041) has the molecular formula C12H11N5
and a molecular weight of 225.26 g/mol. Its IUPAC name is 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine |
| PubChem CID | 126650041 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc(Cc2ccccc2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C12H11N5/c13-10-7-9(6-8-4-2-1-3-5-8)11-12(14-10)16-17-15-11/h1-5,7H,6H2,(H3,13,14,15,16,17) |
| InChIKey | SGFFXIGIHATQNC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine?
The IUPAC name of 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine (CID 126650041) is 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine?
The canonical SMILES for 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine is Nc1cc(Cc2ccccc2)c2n[nH]nc2n1.
What is the InChIKey of 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine?
The InChIKey is SGFFXIGIHATQNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5/c13-10-7-9(6-8-4-2-1-3-5-8)11-12(14-10)16-17-15-11/h1-5,7H,6H2,(H3,13,14,15,16,17).
What are the key properties of 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine?
7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine has a molecular weight of 225.26 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-2H-triazolo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 126650041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).