C26H19F9O4S — CID 126650119
(2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(4-fluorobutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate (PubChem CID 126650119) has the molecular formula C26H19F9O4S and a molecular weight of 598.48 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(4-fluorobutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(4-fluorobutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
|---|---|
| PubChem CID | 126650119 |
| Molecular Formula | C26H19F9O4S |
| Molecular Weight | 598.48 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(4-fluorobutyl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)OCC[C@@H]2c1ccc(C(F)(F)F)cc1CCCCF |
| InChI | InChI=1S/C26H19F9O4S/c27-9-2-1-3-13-11-14(26(33,34)35)4-6-16(13)17-8-10-38-19-12-15(5-7-18(17)19)40(36,37)39-25-23(31)21(29)20(28)22(30)24(25)32/h4-7,11-12,17H,1-3,8-10H2/t17-/m1/s1 |
| InChIKey | PDAUODGRNAMMNP-QGZVFWFLSA-N |
| XLogP | 7.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.48 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|