C29H16F8O6S — CID 126650276
4-[2-[7-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 126650276) has the molecular formula C29H16F8O6S and a molecular weight of 644.49 g/mol. Its IUPAC name is 4-[2-[7-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 4-[2-[7-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 126650276 |
| Molecular Formula | C29H16F8O6S |
| Molecular Weight | 644.49 g/mol |
| Exact Mass | 644.05 |
| IUPAC Name | 4-[2-[7-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(C(F)(F)F)ccc2C2CCOc3cc(S(=O)(=O)Oc4c(F)c(F)c(F)c(F)c4F)ccc32)cc1 |
| InChI | InChI=1S/C29H16F8O6S/c30-22-23(31)25(33)27(26(34)24(22)32)43-44(40,41)16-6-8-19-18(9-10-42-21(19)12-16)17-7-5-15(29(35,36)37)11-20(17)13-1-3-14(4-2-13)28(38)39/h1-8,11-12,18H,9-10H2,(H,38,39) |
| InChIKey | XHZNLRKQUHRWHT-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.49 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|