C25H13F8NO4S2 — CID 126650604
(2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(1,3-thiazol-2-yl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate (PubChem CID 126650604) has the molecular formula C25H13F8NO4S2 and a molecular weight of 607.50 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(1,3-thiazol-2-yl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(1,3-thiazol-2-yl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
|---|---|
| PubChem CID | 126650604 |
| Molecular Formula | C25H13F8NO4S2 |
| Molecular Weight | 607.50 g/mol |
| Exact Mass | 607.02 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (4R)-4-[2-(1,3-thiazol-2-yl)-4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromene-7-sulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)OCC[C@@H]2c1ccc(C(F)(F)F)cc1-c1nccs1 |
| InChI | InChI=1S/C25H13F8NO4S2/c26-18-19(27)21(29)23(22(30)20(18)28)38-40(35,36)12-2-4-15-14(5-7-37-17(15)10-12)13-3-1-11(25(31,32)33)9-16(13)24-34-6-8-39-24/h1-4,6,8-10,14H,5,7H2/t14-/m1/s1 |
| InChIKey | CHLVTINDYMSSOR-CQSZACIVSA-N |
| XLogP | 7.21 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.50 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|