C19H21FN4O5S — CID 126651128
(2R)-4-[6-[4-(3-fluoroazetidin-3-yl)buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 126651128) has the molecular formula C19H21FN4O5S and a molecular weight of 436.47 g/mol. Its IUPAC name is (2R)-4-[6-[4-(3-fluoroazetidin-3-yl)buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[6-[4-(3-fluoroazetidin-3-yl)buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 126651128 |
| Molecular Formula | C19H21FN4O5S |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (2R)-4-[6-[4-(3-fluoroazetidin-3-yl)buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCN1Cc2cc(C#CC#CC3(F)CNC3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C19H21FN4O5S/c1-18(16(25)22-27,30(2,28)29)7-8-23-11-15-9-14(10-24(15)17(23)26)5-3-4-6-19(20)12-21-13-19/h9-10,21,27H,7-8,11-13H2,1-2H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | IYFZBFVPVDFATK-GOSISDBHSA-N |
| XLogP | -0.36 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|