C23H28N4O8S — CID 126651181
5-[2-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-6-yl]penta-2,4-diynyl 4-hydroxypiperidine-1-carboxylate (PubChem CID 126651181) has the molecular formula C23H28N4O8S and a molecular weight of 520.56 g/mol. Its IUPAC name is 5-[2-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-6-yl]penta-2,4-diynyl 4-hydroxypiperidine-1-carboxylate.
| Compound Name | 5-[2-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-6-yl]penta-2,4-diynyl 4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 126651181 |
| Molecular Formula | C23H28N4O8S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 5-[2-[(3R)-4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-6-yl]penta-2,4-diynyl 4-hydroxypiperidine-1-carboxylate |
| SMILES | C[C@@](CCN1Cc2cc(C#CC#CCOC(=O)N3CCC(O)CC3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C23H28N4O8S/c1-23(20(29)24-32,36(2,33)34)9-12-26-16-18-14-17(15-27(18)21(26)30)6-4-3-5-13-35-22(31)25-10-7-19(28)8-11-25/h14-15,19,28,32H,7-13,16H2,1-2H3,(H,24,29)/t23-/m1/s1 |
| InChIKey | KULLPTFZLIDHPA-HSZRJFAPSA-N |
| XLogP | -0.08 |
| TPSA | 158.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|