C21H25FN4O5S — CID 126651203
(2R)-4-[6-[4-[1-(2-fluoroethyl)azetidin-3-yl]buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 126651203) has the molecular formula C21H25FN4O5S and a molecular weight of 464.52 g/mol. Its IUPAC name is (2R)-4-[6-[4-[1-(2-fluoroethyl)azetidin-3-yl]buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[6-[4-[1-(2-fluoroethyl)azetidin-3-yl]buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 126651203 |
| Molecular Formula | C21H25FN4O5S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (2R)-4-[6-[4-[1-(2-fluoroethyl)azetidin-3-yl]buta-1,3-diynyl]-3-oxo-1H-pyrrolo[1,2-c]imidazol-2-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCN1Cc2cc(C#CC#CC3CN(CCF)C3)cn2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C21H25FN4O5S/c1-21(19(27)23-29,32(2,30)31)7-9-25-15-18-11-16(14-26(18)20(25)28)5-3-4-6-17-12-24(13-17)10-8-22/h11,14,17,29H,7-10,12-13,15H2,1-2H3,(H,23,27)/t21-/m1/s1 |
| InChIKey | APPPIBHSMMZCLT-OAQYLSRUSA-N |
| XLogP | 0.23 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|