C36H36F6N2O2 — CID 126651879
1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[4-[4-(2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 126651879) has the molecular formula C36H36F6N2O2 and a molecular weight of 642.68 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[4-[4-(2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[4-[4-(2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 126651879 |
| Molecular Formula | C36H36F6N2O2 |
| Molecular Weight | 642.68 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[4-[4-(2-hydroxypropan-2-yl)phenyl]phenyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(-c2ccc(CN3CCN(Cc4ccc(-c5ccc(C(O)(C(F)(F)F)C(F)(F)F)cc5)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C36H36F6N2O2/c1-33(2,45)31-15-11-29(12-16-31)27-7-3-25(4-8-27)23-43-19-21-44(22-20-43)24-26-5-9-28(10-6-26)30-13-17-32(18-14-30)34(46,35(37,38)39)36(40,41)42/h3-18,45-46H,19-24H2,1-2H3 |
| InChIKey | NPUKEOVFHLDCDS-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.68 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |