C12H14ClNO4 — CID 126652265
(3S,3aR,6aR)-6-(4-amino-2-chlorophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 126652265) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is (3S,3aR,6aR)-6-(4-amino-2-chlorophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3S,3aR,6aR)-6-(4-amino-2-chlorophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 126652265 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (3S,3aR,6aR)-6-(4-amino-2-chlorophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | Nc1ccc(OC2CO[C@H]3[C@@H]2OC[C@@H]3O)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClNO4/c13-7-3-6(14)1-2-9(7)18-10-5-17-11-8(15)4-16-12(10)11/h1-3,8,10-12,15H,4-5,14H2/t8-,10?,11+,12+/m0/s1 |
| InChIKey | PKQNUKGDOCYYHM-MKGKNJBMSA-N |
| XLogP | 0.83 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|