About (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one
(3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one (PubChem CID 126652484) has the molecular formula C19H20Cl2N2O3S
and a molecular weight of 427.35 g/mol. Its IUPAC name is (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one.
Molecular Properties
| Compound Name | (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one |
| PubChem CID | 126652484 |
| Molecular Formula | C19H20Cl2N2O3S |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one |
| SMILES | CS(=O)(=O)N1CC(Cc2ccc(Cl)cc2)NC(=O)[C@@H]1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20Cl2N2O3S/c1-27(25,26)23-12-17(10-13-2-6-15(20)7-3-13)22-19(24)18(23)11-14-4-8-16(21)9-5-14/h2-9,17-18H,10-12H2,1H3,(H,22,24)/t17?,18-/m0/s1 |
| InChIKey | QAABYUDYUCQPIJ-ZVAWYAOSSA-N |
| XLogP | 2.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one?
The IUPAC name of (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one (CID 126652484) is (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one.
What is the SMILES notation for (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one?
The canonical SMILES for (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one is CS(=O)(=O)N1CC(Cc2ccc(Cl)cc2)NC(=O)[C@@H]1Cc1ccc(Cl)cc1.
What is the InChIKey of (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one?
The InChIKey is QAABYUDYUCQPIJ-ZVAWYAOSSA-N. The full InChI is InChI=1S/C19H20Cl2N2O3S/c1-27(25,26)23-12-17(10-13-2-6-15(20)7-3-13)22-19(24)18(23)11-14-4-8-16(21)9-5-14/h2-9,17-18H,10-12H2,1H3,(H,22,24)/t17?,18-/m0/s1.
What are the key properties of (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one?
(3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one has a molecular weight of 427.35 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,6-bis[(4-chlorophenyl)methyl]-4-methylsulfonylpiperazin-2-one is sourced from PubChem (CID 126652484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).