C22H19NO5S — CID 126653033
1-[3-methoxy-5-[1-(4-methylphenyl)sulfonylindol-2-yl]furan-2-yl]ethanone (PubChem CID 126653033) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is 1-[3-methoxy-5-[1-(4-methylphenyl)sulfonylindol-2-yl]furan-2-yl]ethanone.
| Compound Name | 1-[3-methoxy-5-[1-(4-methylphenyl)sulfonylindol-2-yl]furan-2-yl]ethanone |
|---|---|
| PubChem CID | 126653033 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 1-[3-methoxy-5-[1-(4-methylphenyl)sulfonylindol-2-yl]furan-2-yl]ethanone |
| SMILES | COc1cc(-c2cc3ccccc3n2S(=O)(=O)c2ccc(C)cc2)oc1C(C)=O |
| InChI | InChI=1S/C22H19NO5S/c1-14-8-10-17(11-9-14)29(25,26)23-18-7-5-4-6-16(18)12-19(23)20-13-21(27-3)22(28-20)15(2)24/h4-13H,1-3H3 |
| InChIKey | BLDUVAQRKAYQAV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |