C13H23NO5S — CID 126653085
ethyl (6R,7S)-6,7-dimethyl-3-methylsulfonyloxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 126653085) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is ethyl (6R,7S)-6,7-dimethyl-3-methylsulfonyloxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | ethyl (6R,7S)-6,7-dimethyl-3-methylsulfonyloxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 126653085 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | ethyl (6R,7S)-6,7-dimethyl-3-methylsulfonyloxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCOC(=O)N1C2CC(OS(C)(=O)=O)CC1[C@H](C)[C@@H]2C |
| InChI | InChI=1S/C13H23NO5S/c1-5-18-13(15)14-11-6-10(19-20(4,16)17)7-12(14)9(3)8(11)2/h8-12H,5-7H2,1-4H3/t8-,9+,10?,11?,12? |
| InChIKey | DMWVQISQAMMZKK-MXSCYXCISA-N |
| XLogP | 1.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|