About (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine
(E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine (PubChem CID 126653154) has the molecular formula C15H20FNO
and a molecular weight of 249.33 g/mol. Its IUPAC name is (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine |
| PubChem CID | 126653154 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine |
| SMILES | CCO/N=C1\CCc2cc(C(C)(C)C)cc(F)c21 |
| InChI | InChI=1S/C15H20FNO/c1-5-18-17-13-7-6-10-8-11(15(2,3)4)9-12(16)14(10)13/h8-9H,5-7H2,1-4H3/b17-13+ |
| InChIKey | JMYYPIRMHLOUGP-GHRIWEEISA-N |
| XLogP | 3.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine?
The IUPAC name of (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine (CID 126653154) is (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine.
What is the SMILES notation for (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine?
The canonical SMILES for (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine is CCO/N=C1\CCc2cc(C(C)(C)C)cc(F)c21.
What is the InChIKey of (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine?
The InChIKey is JMYYPIRMHLOUGP-GHRIWEEISA-N. The full InChI is InChI=1S/C15H20FNO/c1-5-18-17-13-7-6-10-8-11(15(2,3)4)9-12(16)14(10)13/h8-9H,5-7H2,1-4H3/b17-13+.
What are the key properties of (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine?
(E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine has a molecular weight of 249.33 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-tert-butyl-N-ethoxy-7-fluoro-2,3-dihydroinden-1-imine is sourced from PubChem (CID 126653154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).