About 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide
8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide (PubChem CID 1266532) has the molecular formula C18H26N2O3S
and a molecular weight of 350.48 g/mol. Its IUPAC name is 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide.
Molecular Properties
| Compound Name | 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide |
| PubChem CID | 1266532 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)CC(C)C)c2cccnc12 |
| InChI | InChI=1S/C18H26N2O3S/c1-13(2)11-20(12-14(3)4)24(21,22)17-9-8-16(23-5)18-15(17)7-6-10-19-18/h6-10,13-14H,11-12H2,1-5H3 |
| InChIKey | VZQBLCHPSTWKPT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide?
The IUPAC name of 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide (CID 1266532) is 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide.
What is the SMILES notation for 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide?
The canonical SMILES for 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide is COc1ccc(S(=O)(=O)N(CC(C)C)CC(C)C)c2cccnc12.
What is the InChIKey of 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide?
The InChIKey is VZQBLCHPSTWKPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O3S/c1-13(2)11-20(12-14(3)4)24(21,22)17-9-8-16(23-5)18-15(17)7-6-10-19-18/h6-10,13-14H,11-12H2,1-5H3.
What are the key properties of 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide?
8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide has a molecular weight of 350.48 g/mol, XLogP of 3.55, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-N,N-bis(2-methylpropyl)quinoline-5-sulfonamide is sourced from PubChem (CID 1266532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).