C15H20F2N2O — CID 126653414
3-[[(3R,4S)-3-(2,6-difluoro-4-methylphenyl)-4-methyl-3,4-dihydro-2H-pyrrol-5-yl]amino]propan-1-ol (PubChem CID 126653414) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is 3-[[(3R,4S)-3-(2,6-difluoro-4-methylphenyl)-4-methyl-3,4-dihydro-2H-pyrrol-5-yl]amino]propan-1-ol.
| Compound Name | 3-[[(3R,4S)-3-(2,6-difluoro-4-methylphenyl)-4-methyl-3,4-dihydro-2H-pyrrol-5-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 126653414 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-[[(3R,4S)-3-(2,6-difluoro-4-methylphenyl)-4-methyl-3,4-dihydro-2H-pyrrol-5-yl]amino]propan-1-ol |
| SMILES | Cc1cc(F)c([C@@H]2CN=C(NCCCO)[C@H]2C)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2O/c1-9-6-12(16)14(13(17)7-9)11-8-19-15(10(11)2)18-4-3-5-20/h6-7,10-11,20H,3-5,8H2,1-2H3,(H,18,19)/t10-,11+/m0/s1 |
| InChIKey | WCGZNNUGTASONB-WDEREUQCSA-N |
| XLogP | 2.38 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|