About N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide
N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 126653787) has the molecular formula C12H15FN2O3S
and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide |
| PubChem CID | 126653787 |
| Molecular Formula | C12H15FN2O3S |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)[C@@H]1C[C@@H](F)CN1 |
| InChI | InChI=1S/C12H15FN2O3S/c13-9-6-11(14-7-9)12(16)8-15-19(17,18)10-4-2-1-3-5-10/h1-5,9,11,14-15H,6-8H2/t9-,11+/m1/s1 |
| InChIKey | VDZLJTIICLGMQH-KOLCDFICSA-N |
| XLogP | 0.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide?
The IUPAC name of N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide (CID 126653787) is N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide.
What is the SMILES notation for N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide?
The canonical SMILES for N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide is O=C(CNS(=O)(=O)c1ccccc1)[C@@H]1C[C@@H](F)CN1.
What is the InChIKey of N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide?
The InChIKey is VDZLJTIICLGMQH-KOLCDFICSA-N. The full InChI is InChI=1S/C12H15FN2O3S/c13-9-6-11(14-7-9)12(16)8-15-19(17,18)10-4-2-1-3-5-10/h1-5,9,11,14-15H,6-8H2/t9-,11+/m1/s1.
What are the key properties of N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide?
N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide has a molecular weight of 286.33 g/mol, XLogP of 0.23, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2S,4R)-4-fluoropyrrolidin-2-yl]-2-oxoethyl]benzenesulfonamide is sourced from PubChem (CID 126653787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).