C11H17N — CID 126654021
N-[(5E)-4,5-dimethylocta-1,5,7-trien-3-yl]methanimine (PubChem CID 126654021) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-[(5E)-4,5-dimethylocta-1,5,7-trien-3-yl]methanimine.
| Compound Name | N-[(5E)-4,5-dimethylocta-1,5,7-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 126654021 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-[(5E)-4,5-dimethylocta-1,5,7-trien-3-yl]methanimine |
| SMILES | C=C/C=C(\C)C(C)C(C=C)N=C |
| InChI | InChI=1S/C11H17N/c1-6-8-9(3)10(4)11(7-2)12-5/h6-8,10-11H,1-2,5H2,3-4H3/b9-8+ |
| InChIKey | UAXBTUIYEOTASR-CMDGGOBGSA-N |
| XLogP | 3.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|