About tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate
tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate (PubChem CID 126654201) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate |
| PubChem CID | 126654201 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate |
| SMILES | C=C(/C=C\CC)OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO3/c1-6-7-8-11(2)16-10-9-14-12(15)17-13(3,4)5/h7-8H,2,6,9-10H2,1,3-5H3,(H,14,15)/b8-7- |
| InChIKey | RTHFYRIFIBBAMH-FPLPWBNLSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate (CID 126654201) is tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate is C=C(/C=C\CC)OCCNC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate?
The InChIKey is RTHFYRIFIBBAMH-FPLPWBNLSA-N. The full InChI is InChI=1S/C13H23NO3/c1-6-7-8-11(2)16-10-9-14-12(15)17-13(3,4)5/h7-8H,2,6,9-10H2,1,3-5H3,(H,14,15)/b8-7-.
What are the key properties of tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate?
tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate has a molecular weight of 241.33 g/mol, XLogP of 3.01, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(3Z)-hexa-1,3-dien-2-yl]oxyethyl]carbamate is sourced from PubChem (CID 126654201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).