About N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine
N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine (PubChem CID 126654288) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine |
| PubChem CID | 126654288 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)COC/C=C\COCCNC(C)(C)C |
| InChI | InChI=1S/C15H31NO2/c1-14(2,3)13-18-11-8-7-10-17-12-9-16-15(4,5)6/h7-8,16H,9-13H2,1-6H3/b8-7- |
| InChIKey | CQFXPJPNKRABEB-FPLPWBNLSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine?
The IUPAC name of N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine (CID 126654288) is N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine is CC(C)(C)COC/C=C\COCCNC(C)(C)C.
What is the InChIKey of N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine?
The InChIKey is CQFXPJPNKRABEB-FPLPWBNLSA-N. The full InChI is InChI=1S/C15H31NO2/c1-14(2,3)13-18-11-8-7-10-17-12-9-16-15(4,5)6/h7-8,16H,9-13H2,1-6H3/b8-7-.
What are the key properties of N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine?
N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine has a molecular weight of 257.42 g/mol, XLogP of 3.01, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(Z)-4-(2,2-dimethylpropoxy)but-2-enoxy]ethyl]-2-methylpropan-2-amine is sourced from PubChem (CID 126654288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).